C12H15FN5O13P3 — CID 137062488
[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-2-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 137062488) has the molecular formula C12H15FN5O13P3 and a molecular weight of 549.19 g/mol. Its IUPAC name is [[5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-2-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-2-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 137062488 |
| Molecular Formula | C12H15FN5O13P3 |
| Molecular Weight | 549.19 g/mol |
| Exact Mass | 548.99 |
| IUPAC Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-2-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CC1C(n2cnc3c(=O)[nH]c(N)nc32)OC(F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1O |
| InChI | InChI=1S/C12H15FN5O13P3/c1-2-5-7(19)12(13,3-28-33(24,25)31-34(26,27)30-32(21,22)23)29-10(5)18-4-15-6-8(18)16-11(14)17-9(6)20/h1,4-5,7,10,19H,3H2,(H,24,25)(H,26,27)(H2,21,22,23)(H3,14,16,17,20) |
| InChIKey | JXJFLLPPBPEGJD-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 278.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.19 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|