C13H13F2N5O2 — CID 144828988
2-amino-9-[(4S,5S)-5-ethyl-3-ethynyl-4,5-difluorooxolan-2-yl]-1H-purin-6-one (PubChem CID 144828988) has the molecular formula C13H13F2N5O2 and a molecular weight of 309.28 g/mol. Its IUPAC name is 2-amino-9-[(4S,5S)-5-ethyl-3-ethynyl-4,5-difluorooxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(4S,5S)-5-ethyl-3-ethynyl-4,5-difluorooxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 144828988 |
| Molecular Formula | C13H13F2N5O2 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-amino-9-[(4S,5S)-5-ethyl-3-ethynyl-4,5-difluorooxolan-2-yl]-1H-purin-6-one |
| SMILES | C#CC1C(n2cnc3c(=O)[nH]c(N)nc32)O[C@](F)(CC)[C@H]1F |
| InChI | InChI=1S/C13H13F2N5O2/c1-3-6-8(14)13(15,4-2)22-11(6)20-5-17-7-9(20)18-12(16)19-10(7)21/h1,5-6,8,11H,4H2,2H3,(H3,16,18,19,21)/t6?,8-,11?,13+/m0/s1 |
| InChIKey | AEPZQTLRPWULET-XRMCSIJCSA-N |
| XLogP | 0.89 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|