C13H12N6O4 — CID 137196659
(2R,4S,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolane-3-carbonitrile (PubChem CID 137196659) has the molecular formula C13H12N6O4 and a molecular weight of 316.28 g/mol. Its IUPAC name is (2R,4S,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolane-3-carbonitrile.
| Compound Name | (2R,4S,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolane-3-carbonitrile |
|---|---|
| PubChem CID | 137196659 |
| Molecular Formula | C13H12N6O4 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (2R,4S,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolane-3-carbonitrile |
| SMILES | C#C[C@]1(CO)O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C(C#N)[C@@H]1O |
| InChI | InChI=1S/C13H12N6O4/c1-2-13(4-20)8(21)6(3-14)11(23-13)19-5-16-7-9(19)17-12(15)18-10(7)22/h1,5-6,8,11,20-21H,4H2,(H3,15,17,18,22)/t6?,8-,11+,13+/m0/s1 |
| InChIKey | PUVPASPCCLYOAS-RHXDGGNESA-N |
| XLogP | -1.90 |
| TPSA | 163.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|