C11H13N5O6 — CID 163986255
2-amino-9-[(1R,3R,4R,5S)-4,5,6-trihydroxy-1-(hydroxymethyl)-2-oxabicyclo[3.1.0]hexan-3-yl]-1H-purin-6-one (PubChem CID 163986255) has the molecular formula C11H13N5O6 and a molecular weight of 311.25 g/mol. Its IUPAC name is 2-amino-9-[(1R,3R,4R,5S)-4,5,6-trihydroxy-1-(hydroxymethyl)-2-oxabicyclo[3.1.0]hexan-3-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1R,3R,4R,5S)-4,5,6-trihydroxy-1-(hydroxymethyl)-2-oxabicyclo[3.1.0]hexan-3-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 163986255 |
| Molecular Formula | C11H13N5O6 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-amino-9-[(1R,3R,4R,5S)-4,5,6-trihydroxy-1-(hydroxymethyl)-2-oxabicyclo[3.1.0]hexan-3-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@]3(CO)C(O)[C@]3(O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C11H13N5O6/c12-9-14-5-3(6(19)15-9)13-2-16(5)7-4(18)11(21)8(20)10(11,1-17)22-7/h2,4,7-8,17-18,20-21H,1H2,(H3,12,14,15,19)/t4-,7+,8?,10+,11+/m0/s1 |
| InChIKey | TWPSNAZSPNSXKL-RKTBSANXSA-N |
| XLogP | -3.57 |
| TPSA | 179.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |