C11H13N5O5 — CID 163916891
(1R,3R,4R,5S)-3-(6-aminopurin-9-yl)-1-(hydroxymethyl)-2-oxabicyclo[3.1.0]hexane-4,5,6-triol (PubChem CID 163916891) has the molecular formula C11H13N5O5 and a molecular weight of 295.26 g/mol. Its IUPAC name is (1R,3R,4R,5S)-3-(6-aminopurin-9-yl)-1-(hydroxymethyl)-2-oxabicyclo[3.1.0]hexane-4,5,6-triol.
| Compound Name | (1R,3R,4R,5S)-3-(6-aminopurin-9-yl)-1-(hydroxymethyl)-2-oxabicyclo[3.1.0]hexane-4,5,6-triol |
|---|---|
| PubChem CID | 163916891 |
| Molecular Formula | C11H13N5O5 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | (1R,3R,4R,5S)-3-(6-aminopurin-9-yl)-1-(hydroxymethyl)-2-oxabicyclo[3.1.0]hexane-4,5,6-triol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@]2(CO)C(O)[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C11H13N5O5/c12-6-4-7(14-2-13-6)16(3-15-4)8-5(18)11(20)9(19)10(11,1-17)21-8/h2-3,5,8-9,17-20H,1H2,(H2,12,13,14)/t5-,8+,9?,10+,11+/m0/s1 |
| InChIKey | QXAVQDXHXSEMRD-WXVPYLOESA-N |
| XLogP | -2.87 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |