C11H15N5O5 — CID 57078975
(5R)-5-(6-aminopurin-9-yl)-2,2-bis(hydroxymethyl)oxolane-3,4-diol (PubChem CID 57078975) has the molecular formula C11H15N5O5 and a molecular weight of 297.27 g/mol. Its IUPAC name is (5R)-5-(6-aminopurin-9-yl)-2,2-bis(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (5R)-5-(6-aminopurin-9-yl)-2,2-bis(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57078975 |
| Molecular Formula | C11H15N5O5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (5R)-5-(6-aminopurin-9-yl)-2,2-bis(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1OC(CO)(CO)C(O)C1O |
| InChI | InChI=1S/C11H15N5O5/c12-8-5-9(14-3-13-8)16(4-15-5)10-6(19)7(20)11(1-17,2-18)21-10/h3-4,6-7,10,17-20H,1-2H2,(H2,12,13,14)/t6?,7?,10-/m1/s1 |
| InChIKey | WBNQTEKLVXXLQW-HNQUHTCLSA-N |
| XLogP | -2.62 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |