C12H15N5O4 — CID 174023989
(3R,4R,6R)-6-(6-aminopurin-9-yl)-5-oxaspiro[3.4]octane-3,7,8-triol (PubChem CID 174023989) has the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. Its IUPAC name is (3R,4R,6R)-6-(6-aminopurin-9-yl)-5-oxaspiro[3.4]octane-3,7,8-triol.
| Compound Name | (3R,4R,6R)-6-(6-aminopurin-9-yl)-5-oxaspiro[3.4]octane-3,7,8-triol |
|---|---|
| PubChem CID | 174023989 |
| Molecular Formula | C12H15N5O4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (3R,4R,6R)-6-(6-aminopurin-9-yl)-5-oxaspiro[3.4]octane-3,7,8-triol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@]2(CC[C@H]2O)C(O)C1O |
| InChI | InChI=1S/C12H15N5O4/c13-9-6-10(15-3-14-9)17(4-16-6)11-7(19)8(20)12(21-11)2-1-5(12)18/h3-5,7-8,11,18-20H,1-2H2,(H2,13,14,15)/t5-,7?,8?,11-,12-/m1/s1 |
| InChIKey | RDDHXRKHONTGOQ-AJJWXSESSA-N |
| XLogP | -1.45 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |