C15H24N5O3P — CID 160504953
(2R,3S,4R)-5-(6-aminopurin-9-yl)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-2-methyloxolane-3,4-diol (PubChem CID 160504953) has the molecular formula C15H24N5O3P and a molecular weight of 353.36 g/mol. Its IUPAC name is (2R,3S,4R)-5-(6-aminopurin-9-yl)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-2-methyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-5-(6-aminopurin-9-yl)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-2-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 160504953 |
| Molecular Formula | C15H24N5O3P |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (2R,3S,4R)-5-(6-aminopurin-9-yl)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-2-methyloxolane-3,4-diol |
| SMILES | C=P(C)(C)CC[C@@]1(C)OC(n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H24N5O3P/c1-15(5-6-24(2,3)4)11(22)10(21)14(23-15)20-8-19-9-12(16)17-7-18-13(9)20/h7-8,10-11,14,21-22H,2,5-6H2,1,3-4H3,(H2,16,17,18)/t10-,11+,14?,15-/m1/s1 |
| InChIKey | FRGUPAASIOTYJD-VOFABYSYSA-N |
| XLogP | 0.52 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|