C13H17N5O2 — CID 11737444
(2R,5S,9S)-2-(6-aminopurin-9-yl)-1-oxaspiro[4.4]nonan-9-ol (PubChem CID 11737444) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is (2R,5S,9S)-2-(6-aminopurin-9-yl)-1-oxaspiro[4.4]nonan-9-ol.
| Compound Name | (2R,5S,9S)-2-(6-aminopurin-9-yl)-1-oxaspiro[4.4]nonan-9-ol |
|---|---|
| PubChem CID | 11737444 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | (2R,5S,9S)-2-(6-aminopurin-9-yl)-1-oxaspiro[4.4]nonan-9-ol |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC[C@]2(CCC[C@@H]2O)O1 |
| InChI | InChI=1S/C13H17N5O2/c14-11-10-12(16-6-15-11)18(7-17-10)9-3-5-13(20-9)4-1-2-8(13)19/h6-9,19H,1-5H2,(H2,14,15,16)/t8-,9+,13-/m0/s1 |
| InChIKey | OVFVEBAVTOWPLW-RWEMILLDSA-N |
| XLogP | 1.00 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |