C16H21N5O2 — CID 91670775
(5R,6R)-4-(6-aminopurin-9-yl)-8-oxaspiro[5.6]dodec-10-en-5-ol (PubChem CID 91670775) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is (5R,6R)-4-(6-aminopurin-9-yl)-8-oxaspiro[5.6]dodec-10-en-5-ol.
| Compound Name | (5R,6R)-4-(6-aminopurin-9-yl)-8-oxaspiro[5.6]dodec-10-en-5-ol |
|---|---|
| PubChem CID | 91670775 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (5R,6R)-4-(6-aminopurin-9-yl)-8-oxaspiro[5.6]dodec-10-en-5-ol |
| SMILES | Nc1ncnc2c1ncn2C1CCC[C@]2(CC=CCOC2)[C@H]1O |
| InChI | InChI=1S/C16H21N5O2/c17-14-12-15(19-9-18-14)21(10-20-12)11-4-3-6-16(13(11)22)5-1-2-7-23-8-16/h1-2,9-11,13,22H,3-8H2,(H2,17,18,19)/t11?,13-,16-/m0/s1 |
| InChIKey | ACJYBPGWUPHYJI-DKGPUHFJSA-N |
| XLogP | 1.46 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|