C10H13N5O — CID 15332075
[(1R,2S)-2-(6-aminopurin-9-yl)cyclobutyl]methanol (PubChem CID 15332075) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is [(1R,2S)-2-(6-aminopurin-9-yl)cyclobutyl]methanol.
| Compound Name | [(1R,2S)-2-(6-aminopurin-9-yl)cyclobutyl]methanol |
|---|---|
| PubChem CID | 15332075 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | [(1R,2S)-2-(6-aminopurin-9-yl)cyclobutyl]methanol |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC[C@H]1CO |
| InChI | InChI=1S/C10H13N5O/c11-9-8-10(13-4-12-9)15(5-14-8)7-2-1-6(7)3-16/h4-7,16H,1-3H2,(H2,11,12,13)/t6-,7-/m0/s1 |
| InChIKey | CNCYBSHSXAUTJK-BQBZGAKWSA-N |
| XLogP | 0.35 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |