C10H14ClN5O2 — CID 67400783
(1R,2S,3S)-3-(6-aminopurin-9-yl)cyclopentane-1,2-diol;hydrochloride (PubChem CID 67400783) has the molecular formula C10H14ClN5O2 and a molecular weight of 271.71 g/mol. Its IUPAC name is (1R,2S,3S)-3-(6-aminopurin-9-yl)cyclopentane-1,2-diol;hydrochloride.
| Compound Name | (1R,2S,3S)-3-(6-aminopurin-9-yl)cyclopentane-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 67400783 |
| Molecular Formula | C10H14ClN5O2 |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (1R,2S,3S)-3-(6-aminopurin-9-yl)cyclopentane-1,2-diol;hydrochloride |
| SMILES | Cl.Nc1ncnc2c1ncn2[C@H]1CC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H13N5O2.ClH/c11-9-7-10(13-3-12-9)15(4-14-7)5-1-2-6(16)8(5)17;/h3-6,8,16-17H,1-2H2,(H2,11,12,13);1H/t5-,6+,8-;/m0./s1 |
| InChIKey | XZNPFBKVRLWEEG-CLFDHOPQSA-N |
| XLogP | -0.11 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |