C11H16N6O — CID 144745895
4-(aminomethyl)-2-(6-aminopurin-9-yl)cyclopentan-1-ol (PubChem CID 144745895) has the molecular formula C11H16N6O and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-(aminomethyl)-2-(6-aminopurin-9-yl)cyclopentan-1-ol.
| Compound Name | 4-(aminomethyl)-2-(6-aminopurin-9-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 144745895 |
| Molecular Formula | C11H16N6O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-(aminomethyl)-2-(6-aminopurin-9-yl)cyclopentan-1-ol |
| SMILES | NCC1CC(O)C(n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C11H16N6O/c12-3-6-1-7(8(18)2-6)17-5-16-9-10(13)14-4-15-11(9)17/h4-8,18H,1-3,12H2,(H2,13,14,15) |
| InChIKey | ZPEZXAKGFWUPDM-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |