C12H17N5O — CID 10681944
2-[(1R,2S)-2-(6-aminopurin-9-yl)cyclopentyl]ethanol (PubChem CID 10681944) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-[(1R,2S)-2-(6-aminopurin-9-yl)cyclopentyl]ethanol.
| Compound Name | 2-[(1R,2S)-2-(6-aminopurin-9-yl)cyclopentyl]ethanol |
|---|---|
| PubChem CID | 10681944 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-[(1R,2S)-2-(6-aminopurin-9-yl)cyclopentyl]ethanol |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CCC[C@@H]1CCO |
| InChI | InChI=1S/C12H17N5O/c13-11-10-12(15-6-14-11)17(7-16-10)9-3-1-2-8(9)4-5-18/h6-9,18H,1-5H2,(H2,13,14,15)/t8-,9+/m1/s1 |
| InChIKey | RAKVCENGJBJANY-BDAKNGLRSA-N |
| XLogP | 1.13 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |