C11H13N5O3 — CID 162845253
4-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclopentene-1,3-diol (PubChem CID 162845253) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclopentene-1,3-diol.
| Compound Name | 4-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclopentene-1,3-diol |
|---|---|
| PubChem CID | 162845253 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 4-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclopentene-1,3-diol |
| SMILES | Nc1ncnc2c1ncn2C1CC(O)=C(CO)C1O |
| InChI | InChI=1S/C11H13N5O3/c12-10-8-11(14-3-13-10)16(4-15-8)6-1-7(18)5(2-17)9(6)19/h3-4,6,9,17-19H,1-2H2,(H2,12,13,14) |
| InChIKey | OLQGNBWDUALSOQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |