C11H12IN5O3 — CID 53318848
(1S,2R,5S)-5-(6-aminopurin-9-yl)-3-(hydroxymethyl)-4-iodocyclopent-3-ene-1,2-diol (PubChem CID 53318848) has the molecular formula C11H12IN5O3 and a molecular weight of 389.15 g/mol. Its IUPAC name is (1S,2R,5S)-5-(6-aminopurin-9-yl)-3-(hydroxymethyl)-4-iodocyclopent-3-ene-1,2-diol.
| Compound Name | (1S,2R,5S)-5-(6-aminopurin-9-yl)-3-(hydroxymethyl)-4-iodocyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 53318848 |
| Molecular Formula | C11H12IN5O3 |
| Molecular Weight | 389.15 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | (1S,2R,5S)-5-(6-aminopurin-9-yl)-3-(hydroxymethyl)-4-iodocyclopent-3-ene-1,2-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1C(I)=C(CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H12IN5O3/c12-5-4(1-18)8(19)9(20)7(5)17-3-16-6-10(13)14-2-15-11(6)17/h2-3,7-9,18-20H,1H2,(H2,13,14,15)/t7-,8-,9+/m1/s1 |
| InChIKey | WMZNOGDJDZBFTH-HLTSFMKQSA-N |
| XLogP | -0.63 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.15 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|