C12H14FN5O2 — CID 121320951
trans-(2S,5R)-3-(6-aminopurin-9-yl)-2-fluoro-5-(hydroxymethyl)-4-methylidenecyclopentan-1-ol (PubChem CID 121320951) has the molecular formula C12H14FN5O2 and a molecular weight of 279.28 g/mol. Its IUPAC name is trans-(2S,5R)-3-(6-aminopurin-9-yl)-2-fluoro-5-(hydroxymethyl)-4-methylidenecyclopentan-1-ol.
| Compound Name | trans-(2S,5R)-3-(6-aminopurin-9-yl)-2-fluoro-5-(hydroxymethyl)-4-methylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 121320951 |
| Molecular Formula | C12H14FN5O2 |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | trans-(2S,5R)-3-(6-aminopurin-9-yl)-2-fluoro-5-(hydroxymethyl)-4-methylidenecyclopentan-1-ol |
| SMILES | C=C1C(n2cnc3c(N)ncnc32)[C@H](F)C(O)[C@H]1CO |
| InChI | InChI=1S/C12H14FN5O2/c1-5-6(2-19)10(20)7(13)9(5)18-4-17-8-11(14)15-3-16-12(8)18/h3-4,6-7,9-10,19-20H,1-2H2,(H2,14,15,16)/t6-,7-,9?,10?/m0/s1 |
| InChIKey | QSIOZNXDXNWPNX-PYMHSVQESA-N |
| XLogP | -0.17 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|