C12H12N6O — CID 147729560
(1R,2S,4R)-2-(6-aminopurin-9-yl)-4-(hydroxymethyl)-3-methylidenecyclobutane-1-carbonitrile (PubChem CID 147729560) has the molecular formula C12H12N6O and a molecular weight of 256.27 g/mol. Its IUPAC name is (1R,2S,4R)-2-(6-aminopurin-9-yl)-4-(hydroxymethyl)-3-methylidenecyclobutane-1-carbonitrile.
| Compound Name | (1R,2S,4R)-2-(6-aminopurin-9-yl)-4-(hydroxymethyl)-3-methylidenecyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 147729560 |
| Molecular Formula | C12H12N6O |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (1R,2S,4R)-2-(6-aminopurin-9-yl)-4-(hydroxymethyl)-3-methylidenecyclobutane-1-carbonitrile |
| SMILES | C=C1[C@@H](n2cnc3c(N)ncnc32)[C@H](C#N)[C@H]1CO |
| InChI | InChI=1S/C12H12N6O/c1-6-8(3-19)7(2-13)10(6)18-5-17-9-11(14)15-4-16-12(9)18/h4-5,7-8,10,19H,1,3H2,(H2,14,15,16)/t7-,8+,10-/m1/s1 |
| InChIKey | GYDORGOQLKUWLO-KHQFGBGNSA-N |
| XLogP | 0.27 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|