C13H15N5O2 — CID 59157831
(1R,2R,4R,5S)-4-(6-aminopurin-9-yl)-1-(hydroxymethyl)-3-methylidenebicyclo[3.1.0]hexan-2-ol (PubChem CID 59157831) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is (1R,2R,4R,5S)-4-(6-aminopurin-9-yl)-1-(hydroxymethyl)-3-methylidenebicyclo[3.1.0]hexan-2-ol.
| Compound Name | (1R,2R,4R,5S)-4-(6-aminopurin-9-yl)-1-(hydroxymethyl)-3-methylidenebicyclo[3.1.0]hexan-2-ol |
|---|---|
| PubChem CID | 59157831 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (1R,2R,4R,5S)-4-(6-aminopurin-9-yl)-1-(hydroxymethyl)-3-methylidenebicyclo[3.1.0]hexan-2-ol |
| SMILES | C=C1[C@@H](O)[C@]2(CO)C[C@@H]2[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H15N5O2/c1-6-9(7-2-13(7,3-19)10(6)20)18-5-17-8-11(14)15-4-16-12(8)18/h4-5,7,9-10,19-20H,1-3H2,(H2,14,15,16)/t7-,9+,10-,13+/m1/s1 |
| InChIKey | SCNYLHKTGGFYGK-GWESGZDDSA-N |
| XLogP | -0.12 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|