C11H14FN5O — CID 11230472
[(1R,3R)-3-(6-aminopurin-9-yl)-1-fluorocyclopentyl]methanol (PubChem CID 11230472) has the molecular formula C11H14FN5O and a molecular weight of 251.26 g/mol. Its IUPAC name is [(1R,3R)-3-(6-aminopurin-9-yl)-1-fluorocyclopentyl]methanol.
| Compound Name | [(1R,3R)-3-(6-aminopurin-9-yl)-1-fluorocyclopentyl]methanol |
|---|---|
| PubChem CID | 11230472 |
| Molecular Formula | C11H14FN5O |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | [(1R,3R)-3-(6-aminopurin-9-yl)-1-fluorocyclopentyl]methanol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1CC[C@](F)(CO)C1 |
| InChI | InChI=1S/C11H14FN5O/c12-11(4-18)2-1-7(3-11)17-6-16-8-9(13)14-5-15-10(8)17/h5-7,18H,1-4H2,(H2,13,14,15)/t7-,11-/m1/s1 |
| InChIKey | LRLOIMNCYKAUQU-RDDDGLTNSA-N |
| XLogP | 0.83 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |