C11H13ClFN5O2 — CID 144766812
[(2S,4R,5R)-5-(6-aminopurin-9-yl)-2-(chloromethyl)-4-fluorooxolan-2-yl]methanol (PubChem CID 144766812) has the molecular formula C11H13ClFN5O2 and a molecular weight of 301.71 g/mol. Its IUPAC name is [(2S,4R,5R)-5-(6-aminopurin-9-yl)-2-(chloromethyl)-4-fluorooxolan-2-yl]methanol.
| Compound Name | [(2S,4R,5R)-5-(6-aminopurin-9-yl)-2-(chloromethyl)-4-fluorooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 144766812 |
| Molecular Formula | C11H13ClFN5O2 |
| Molecular Weight | 301.71 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | [(2S,4R,5R)-5-(6-aminopurin-9-yl)-2-(chloromethyl)-4-fluorooxolan-2-yl]methanol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@](CO)(CCl)C[C@H]1F |
| InChI | InChI=1S/C11H13ClFN5O2/c12-2-11(3-19)1-6(13)10(20-11)18-5-17-7-8(14)15-4-16-9(7)18/h4-6,10,19H,1-3H2,(H2,14,15,16)/t6-,10-,11-/m1/s1 |
| InChIKey | CEOOJIBJFQOMHF-DIMCTHFVSA-N |
| XLogP | 0.64 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.71 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|