C10H12FN5O2 — CID 10858004
[(2S,4S,5R)-5-(6-aminopurin-9-yl)-3-deuterio-4-fluorooxolan-2-yl]methanol (PubChem CID 10858004) has the molecular formula C10H12FN5O2 and a molecular weight of 254.24 g/mol. Its IUPAC name is [(2S,4S,5R)-5-(6-aminopurin-9-yl)-3-deuterio-4-fluorooxolan-2-yl]methanol.
| Compound Name | [(2S,4S,5R)-5-(6-aminopurin-9-yl)-3-deuterio-4-fluorooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 10858004 |
| Molecular Formula | C10H12FN5O2 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | [(2S,4S,5R)-5-(6-aminopurin-9-yl)-3-deuterio-4-fluorooxolan-2-yl]methanol |
| SMILES | [2H]C1[C@@H](CO)O[C@@H](n2cnc3c(N)ncnc32)[C@H]1F |
| InChI | InChI=1S/C10H12FN5O2/c11-6-1-5(2-17)18-10(6)16-4-15-7-8(12)13-3-14-9(7)16/h3-6,10,17H,1-2H2,(H2,12,13,14)/t5-,6-,10+/m0/s1/i1D/t1?,5-,6-,10+ |
| InChIKey | KBEMFSMODRNJHE-BXOOQQRFSA-N |
| XLogP | 0.03 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |