C10H13FN6O2 — CID 21145488
(2R,3S,5R)-5-(aminomethyl)-2-(6-aminopurin-9-yl)-4-fluorooxolan-3-ol (PubChem CID 21145488) has the molecular formula C10H13FN6O2 and a molecular weight of 268.25 g/mol. Its IUPAC name is (2R,3S,5R)-5-(aminomethyl)-2-(6-aminopurin-9-yl)-4-fluorooxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(aminomethyl)-2-(6-aminopurin-9-yl)-4-fluorooxolan-3-ol |
|---|---|
| PubChem CID | 21145488 |
| Molecular Formula | C10H13FN6O2 |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2R,3S,5R)-5-(aminomethyl)-2-(6-aminopurin-9-yl)-4-fluorooxolan-3-ol |
| SMILES | NC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)C1F |
| InChI | InChI=1S/C10H13FN6O2/c11-5-4(1-12)19-10(7(5)18)17-3-16-6-8(13)14-2-15-9(6)17/h2-5,7,10,18H,1,12H2,(H2,13,14,15)/t4-,5?,7-,10-/m1/s1 |
| InChIKey | JAVBHBHAMQYQAN-QKIGGPNISA-N |
| XLogP | -1.04 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |