C10H11N5O2P2 — CID 57063873
9-(3,3-diphosphorosocyclopentyl)purin-6-amine (PubChem CID 57063873) has the molecular formula C10H11N5O2P2 and a molecular weight of 295.18 g/mol. Its IUPAC name is 9-(3,3-diphosphorosocyclopentyl)purin-6-amine.
| Compound Name | 9-(3,3-diphosphorosocyclopentyl)purin-6-amine |
|---|---|
| PubChem CID | 57063873 |
| Molecular Formula | C10H11N5O2P2 |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 9-(3,3-diphosphorosocyclopentyl)purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2C1CCC(P=O)(P=O)C1 |
| InChI | InChI=1S/C10H11N5O2P2/c11-8-7-9(13-4-12-8)15(5-14-7)6-1-2-10(3-6,18-16)19-17/h4-6H,1-3H2,(H2,11,12,13) |
| InChIKey | DRCJEGXHPSPNPO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|