C12H15N5O4 — CID 18388896
(1R,2S,3R,4R,5R,7S)-3-(6-aminopurin-9-yl)bicyclo[2.2.1]heptane-1,2,5,7-tetrol (PubChem CID 18388896) has the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R,7S)-3-(6-aminopurin-9-yl)bicyclo[2.2.1]heptane-1,2,5,7-tetrol.
| Compound Name | (1R,2S,3R,4R,5R,7S)-3-(6-aminopurin-9-yl)bicyclo[2.2.1]heptane-1,2,5,7-tetrol |
|---|---|
| PubChem CID | 18388896 |
| Molecular Formula | C12H15N5O4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (1R,2S,3R,4R,5R,7S)-3-(6-aminopurin-9-yl)bicyclo[2.2.1]heptane-1,2,5,7-tetrol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1[C@@H]2[C@H](O)C[C@@](O)([C@H]2O)[C@H]1O |
| InChI | InChI=1S/C12H15N5O4/c13-10-6-11(15-2-14-10)17(3-16-6)7-5-4(18)1-12(21,8(5)19)9(7)20/h2-5,7-9,18-21H,1H2,(H2,13,14,15)/t4-,5+,7-,8+,9+,12-/m1/s1 |
| InChIKey | XAAGPRPGHZXIDI-QJDNARSMSA-N |
| XLogP | -2.20 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |