C13H16N5O5P — CID 123622525
2-[(4S)-4-(6-aminopurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]ethenylphosphonic acid (PubChem CID 123622525) has the molecular formula C13H16N5O5P and a molecular weight of 353.28 g/mol. Its IUPAC name is 2-[(4S)-4-(6-aminopurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]ethenylphosphonic acid.
| Compound Name | 2-[(4S)-4-(6-aminopurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]ethenylphosphonic acid |
|---|---|
| PubChem CID | 123622525 |
| Molecular Formula | C13H16N5O5P |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-[(4S)-4-(6-aminopurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]ethenylphosphonic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1C(O)C(O)C2(C=CP(=O)(O)O)CC12 |
| InChI | InChI=1S/C13H16N5O5P/c14-11-7-12(16-4-15-11)18(5-17-7)8-6-3-13(6,10(20)9(8)19)1-2-24(21,22)23/h1-2,4-6,8-10,19-20H,3H2,(H2,14,15,16)(H2,21,22,23)/t6?,8-,9?,10?,13?/m0/s1 |
| InChIKey | XGKYCSUSLVPIMR-ABPUAYKZSA-N |
| XLogP | -0.62 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|