C9H14N5O8P — CID 91654157
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl] dihydrogen phosphate;hydrate (PubChem CID 91654157) has the molecular formula C9H14N5O8P and a molecular weight of 351.21 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl] dihydrogen phosphate;hydrate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl] dihydrogen phosphate;hydrate |
|---|---|
| PubChem CID | 91654157 |
| Molecular Formula | C9H14N5O8P |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl] dihydrogen phosphate;hydrate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](OP(=O)(O)O)[C@@H](O)[C@H]1O.O |
| InChI | InChI=1S/C9H12N5O7P.H2O/c10-6-3-7(12-1-11-6)14(2-13-3)8-4(15)5(16)9(20-8)21-22(17,18)19;/h1-2,4-5,8-9,15-16H,(H2,10,11,12)(H2,17,18,19);1H2/t4-,5+,8-,9-;/m1./s1 |
| InChIKey | IXSMYCMKZVCSCD-RLYRBLFQSA-N |
| XLogP | -2.73 |
| TPSA | 217.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|