C10H16N5O13P3 — CID 3615191
[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]oxy-[[hydroxy(phosphonooxy)phosphoryl]oxymethyl]phosphinic acid (PubChem CID 3615191) has the molecular formula C10H16N5O13P3 and a molecular weight of 507.18 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]oxy-[[hydroxy(phosphonooxy)phosphoryl]oxymethyl]phosphinic acid.
| Compound Name | [5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]oxy-[[hydroxy(phosphonooxy)phosphoryl]oxymethyl]phosphinic acid |
|---|---|
| PubChem CID | 3615191 |
| Molecular Formula | C10H16N5O13P3 |
| Molecular Weight | 507.18 g/mol |
| Exact Mass | 507.00 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]oxy-[[hydroxy(phosphonooxy)phosphoryl]oxymethyl]phosphinic acid |
| SMILES | Nc1ncnc2c1ncn2C1OC(OP(=O)(O)COP(=O)(O)OP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C10H16N5O13P3/c11-7-4-8(13-1-12-7)15(2-14-4)9-5(16)6(17)10(26-9)27-29(18,19)3-25-31(23,24)28-30(20,21)22/h1-2,5-6,9-10,16-17H,3H2,(H,18,19)(H,23,24)(H2,11,12,13)(H2,20,21,22) |
| InChIKey | GSAMLPFQTCNKAA-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 279.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.18 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|