C10H12N5O3 — CID 135030783
CID 135030783 (PubChem CID 135030783) has the molecular formula C10H12N5O3 and a molecular weight of 250.24 g/mol.
| Compound Name | CID 135030783 |
|---|---|
| PubChem CID | 135030783 |
| Molecular Formula | C10H12N5O3 |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | — |
| SMILES | [CH2]C1OC(n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H12N5O3/c1-4-6(16)7(17)10(18-4)15-3-14-5-8(11)12-2-13-9(5)15/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)/t4?,6-,7-,10?/m1/s1 |
| InChIKey | FMJPFPZKXLRBOJ-NYDYUERISA-N |
| XLogP | -1.14 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |