C10H14N6 — CID 51050700
9-[(3S)-piperidin-3-yl]purin-6-amine (PubChem CID 51050700) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 9-[(3S)-piperidin-3-yl]purin-6-amine.
| Compound Name | 9-[(3S)-piperidin-3-yl]purin-6-amine |
|---|---|
| PubChem CID | 51050700 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 9-[(3S)-piperidin-3-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CCCNC1 |
| InChI | InChI=1S/C10H14N6/c11-9-8-10(14-5-13-9)16(6-15-8)7-2-1-3-12-4-7/h5-7,12H,1-4H2,(H2,11,13,14)/t7-/m0/s1 |
| InChIKey | BEMAJBTVSLXFLA-ZETCQYMHSA-N |
| XLogP | 0.33 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |