C11H14N6 — CID 57328036
9-[(1S,4R,6S)-2-azabicyclo[2.2.1]heptan-6-yl]purin-6-amine (PubChem CID 57328036) has the molecular formula C11H14N6 and a molecular weight of 230.27 g/mol. Its IUPAC name is 9-[(1S,4R,6S)-2-azabicyclo[2.2.1]heptan-6-yl]purin-6-amine.
| Compound Name | 9-[(1S,4R,6S)-2-azabicyclo[2.2.1]heptan-6-yl]purin-6-amine |
|---|---|
| PubChem CID | 57328036 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 9-[(1S,4R,6S)-2-azabicyclo[2.2.1]heptan-6-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@@H]2CN[C@H]1C2 |
| InChI | InChI=1S/C11H14N6/c12-10-9-11(15-4-14-10)17(5-16-9)8-2-6-1-7(8)13-3-6/h4-8,13H,1-3H2,(H2,12,14,15)/t6-,7+,8+/m1/s1 |
| InChIKey | OPSPMSLLTSJTPB-CSMHCCOUSA-N |
| XLogP | 0.33 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |