C14H17N5S — CID 71595336
9-[(1R,2S,6R,7R)-4-thiatricyclo[5.2.1.02,6]decan-8-yl]purin-6-amine (PubChem CID 71595336) has the molecular formula C14H17N5S and a molecular weight of 287.39 g/mol. Its IUPAC name is 9-[(1R,2S,6R,7R)-4-thiatricyclo[5.2.1.02,6]decan-8-yl]purin-6-amine.
| Compound Name | 9-[(1R,2S,6R,7R)-4-thiatricyclo[5.2.1.02,6]decan-8-yl]purin-6-amine |
|---|---|
| PubChem CID | 71595336 |
| Molecular Formula | C14H17N5S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 9-[(1R,2S,6R,7R)-4-thiatricyclo[5.2.1.02,6]decan-8-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2C1C[C@H]2C[C@@H]1[C@H]1CSC[C@@H]21 |
| InChI | InChI=1S/C14H17N5S/c15-13-12-14(17-5-16-13)19(6-18-12)11-2-7-1-8(11)10-4-20-3-9(7)10/h5-11H,1-4H2,(H2,15,16,17)/t7-,8-,9+,10-,11?/m1/s1 |
| InChIKey | YSHROGCOFFRXHC-YBTJCZCISA-N |
| XLogP | 1.97 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |