C14H15ClN4S — CID 71595335
6-chloro-9-[(1R,2R,6S,7R)-4-thiatricyclo[5.2.1.02,6]decan-8-yl]purine (PubChem CID 71595335) has the molecular formula C14H15ClN4S and a molecular weight of 306.82 g/mol. Its IUPAC name is 6-chloro-9-[(1R,2R,6S,7R)-4-thiatricyclo[5.2.1.02,6]decan-8-yl]purine.
| Compound Name | 6-chloro-9-[(1R,2R,6S,7R)-4-thiatricyclo[5.2.1.02,6]decan-8-yl]purine |
|---|---|
| PubChem CID | 71595335 |
| Molecular Formula | C14H15ClN4S |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 6-chloro-9-[(1R,2R,6S,7R)-4-thiatricyclo[5.2.1.02,6]decan-8-yl]purine |
| SMILES | Clc1ncnc2c1ncn2C1C[C@H]2C[C@@H]1[C@@H]1CSC[C@H]21 |
| InChI | InChI=1S/C14H15ClN4S/c15-13-12-14(17-5-16-13)19(6-18-12)11-2-7-1-8(11)10-4-20-3-9(7)10/h5-11H,1-4H2/t7-,8-,9-,10+,11?/m1/s1 |
| InChIKey | RKBMFKCHENGKJJ-UZJMVKBUSA-N |
| XLogP | 3.04 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |