C12H12Cl2N4O — CID 42612545
6-chloro-9-[(1R,2S,4S,6R)-6-(chloromethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]purine (PubChem CID 42612545) has the molecular formula C12H12Cl2N4O and a molecular weight of 299.16 g/mol. Its IUPAC name is 6-chloro-9-[(1R,2S,4S,6R)-6-(chloromethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]purine.
| Compound Name | 6-chloro-9-[(1R,2S,4S,6R)-6-(chloromethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]purine |
|---|---|
| PubChem CID | 42612545 |
| Molecular Formula | C12H12Cl2N4O |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 6-chloro-9-[(1R,2S,4S,6R)-6-(chloromethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]purine |
| SMILES | ClC[C@@H]1C[C@H]2C[C@H](n3cnc4c(Cl)ncnc43)[C@@H]1O2 |
| InChI | InChI=1S/C12H12Cl2N4O/c13-3-6-1-7-2-8(10(6)19-7)18-5-17-9-11(14)15-4-16-12(9)18/h4-8,10H,1-3H2/t6-,7-,8-,10+/m0/s1 |
| InChIKey | LCDAPYPIROJZNI-AZQAYCESSA-N |
| XLogP | 2.44 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|