C15H17ClF2N4O3 — CID 87827174
9-[(3aS,4R,6R,6aR)-6-(difluoromethoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-chloropurine (PubChem CID 87827174) has the molecular formula C15H17ClF2N4O3 and a molecular weight of 374.78 g/mol. Its IUPAC name is 9-[(3aS,4R,6R,6aR)-6-(difluoromethoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-chloropurine.
| Compound Name | 9-[(3aS,4R,6R,6aR)-6-(difluoromethoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-chloropurine |
|---|---|
| PubChem CID | 87827174 |
| Molecular Formula | C15H17ClF2N4O3 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 9-[(3aS,4R,6R,6aR)-6-(difluoromethoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-chloropurine |
| SMILES | CC1(C)O[C@@H]2[C@@H](COC(F)F)C[C@@H](n3cnc4c(Cl)ncnc43)[C@@H]2O1 |
| InChI | InChI=1S/C15H17ClF2N4O3/c1-15(2)24-10-7(4-23-14(17)18)3-8(11(10)25-15)22-6-21-9-12(16)19-5-20-13(9)22/h5-8,10-11,14H,3-4H2,1-2H3/t7-,8-,10-,11+/m1/s1 |
| InChIKey | BQOCPWHTRVUOSH-OYBPUVFXSA-N |
| XLogP | 2.80 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |