C13H12ClN5O3 — CID 118603276
(4R,6R,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonitrile (PubChem CID 118603276) has the molecular formula C13H12ClN5O3 and a molecular weight of 321.72 g/mol. Its IUPAC name is (4R,6R,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonitrile.
| Compound Name | (4R,6R,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonitrile |
|---|---|
| PubChem CID | 118603276 |
| Molecular Formula | C13H12ClN5O3 |
| Molecular Weight | 321.72 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (4R,6R,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonitrile |
| SMILES | CC1(C)OC2[C@@H](O1)[C@@H](C#N)O[C@H]2n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C13H12ClN5O3/c1-13(2)21-8-6(3-15)20-12(9(8)22-13)19-5-18-7-10(14)16-4-17-11(7)19/h4-6,8-9,12H,1-2H3/t6-,8+,9?,12-/m1/s1 |
| InChIKey | AXIYAWPKUWIFSN-HRLNAYTHSA-N |
| XLogP | 1.42 |
| TPSA | 95.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.72 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |