C19H19ClN4O3S — CID 87303702
9-[(3aR,4R,6S,6aR)-2,2-dimethyl-6-(phenylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-chloropurine (PubChem CID 87303702) has the molecular formula C19H19ClN4O3S and a molecular weight of 418.91 g/mol. Its IUPAC name is 9-[(3aR,4R,6S,6aR)-2,2-dimethyl-6-(phenylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-chloropurine.
| Compound Name | 9-[(3aR,4R,6S,6aR)-2,2-dimethyl-6-(phenylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-chloropurine |
|---|---|
| PubChem CID | 87303702 |
| Molecular Formula | C19H19ClN4O3S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 9-[(3aR,4R,6S,6aR)-2,2-dimethyl-6-(phenylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-chloropurine |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](CSc1ccccc1)O[C@H]2n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C19H19ClN4O3S/c1-19(2)26-14-12(8-28-11-6-4-3-5-7-11)25-18(15(14)27-19)24-10-23-13-16(20)21-9-22-17(13)24/h3-7,9-10,12,14-15,18H,8H2,1-2H3/t12-,14+,15-,18-/m1/s1 |
| InChIKey | FFLQIQGDKAIRJG-MJXUCMMTSA-N |
| XLogP | 3.69 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |