C13H13ClN4O5 — CID 134692425
(3aR,4R,6S)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid (PubChem CID 134692425) has the molecular formula C13H13ClN4O5 and a molecular weight of 340.72 g/mol. Its IUPAC name is (3aR,4R,6S)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid.
| Compound Name | (3aR,4R,6S)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid |
|---|---|
| PubChem CID | 134692425 |
| Molecular Formula | C13H13ClN4O5 |
| Molecular Weight | 340.72 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (3aR,4R,6S)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid |
| SMILES | CC1(C)OC2[C@@H](C(=O)O)O[C@@H](n3cnc4c(Cl)ncnc43)[C@@H]2O1 |
| InChI | InChI=1S/C13H13ClN4O5/c1-13(2)22-6-7(23-13)11(21-8(6)12(19)20)18-4-17-5-9(14)15-3-16-10(5)18/h3-4,6-8,11H,1-2H3,(H,19,20)/t6?,7-,8+,11-/m1/s1 |
| InChIKey | BWQOSYSWEARUOW-IOCSBZMTSA-N |
| XLogP | 0.98 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.72 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |