C23H25ClN4O5 — CID 58940538
6-chloro-9-[(1S,2R,3R,7R,8R,10R)-2,5,5-trimethyl-13-phenyl-4,6,9,12,14-pentaoxatricyclo[8.4.0.03,7]tetradecan-8-yl]purine (PubChem CID 58940538) has the molecular formula C23H25ClN4O5 and a molecular weight of 472.93 g/mol. Its IUPAC name is 6-chloro-9-[(1S,2R,3R,7R,8R,10R)-2,5,5-trimethyl-13-phenyl-4,6,9,12,14-pentaoxatricyclo[8.4.0.03,7]tetradecan-8-yl]purine.
| Compound Name | 6-chloro-9-[(1S,2R,3R,7R,8R,10R)-2,5,5-trimethyl-13-phenyl-4,6,9,12,14-pentaoxatricyclo[8.4.0.03,7]tetradecan-8-yl]purine |
|---|---|
| PubChem CID | 58940538 |
| Molecular Formula | C23H25ClN4O5 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 6-chloro-9-[(1S,2R,3R,7R,8R,10R)-2,5,5-trimethyl-13-phenyl-4,6,9,12,14-pentaoxatricyclo[8.4.0.03,7]tetradecan-8-yl]purine |
| SMILES | C[C@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](n2cnc3c(Cl)ncnc32)O[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C23H25ClN4O5/c1-12-16-14(9-29-22(31-16)13-7-5-4-6-8-13)30-21(18-17(12)32-23(2,3)33-18)28-11-27-15-19(24)25-10-26-20(15)28/h4-8,10-12,14,16-18,21-22H,9H2,1-3H3/t12-,14-,16+,17-,18-,21-,22?/m1/s1 |
| InChIKey | IGGZOWFZTCPSQA-HEYNQQNXSA-N |
| XLogP | 3.65 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |