C13H13ClN4O2 — CID 163281984
9-[(3aS,4R,6aR)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-chloropurine (PubChem CID 163281984) has the molecular formula C13H13ClN4O2 and a molecular weight of 292.73 g/mol. Its IUPAC name is 9-[(3aS,4R,6aR)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-chloropurine.
| Compound Name | 9-[(3aS,4R,6aR)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-chloropurine |
|---|---|
| PubChem CID | 163281984 |
| Molecular Formula | C13H13ClN4O2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 9-[(3aS,4R,6aR)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-chloropurine |
| SMILES | CC1(C)O[C@H]2[C@H](n3cnc4c(Cl)ncnc43)C=C[C@H]2O1 |
| InChI | InChI=1S/C13H13ClN4O2/c1-13(2)19-8-4-3-7(10(8)20-13)18-6-17-9-11(14)15-5-16-12(9)18/h3-8,10H,1-2H3/t7-,8-,10+/m1/s1 |
| InChIKey | YHUROXUBEHHDFH-MRTMQBJTSA-N |
| XLogP | 2.11 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|