C15H17ClN4O4 — CID 11696044
[(3aR,4S,6R,6aS)-6-(6-chloropurin-9-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] acetate (PubChem CID 11696044) has the molecular formula C15H17ClN4O4 and a molecular weight of 352.78 g/mol. Its IUPAC name is [(3aR,4S,6R,6aS)-6-(6-chloropurin-9-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] acetate.
| Compound Name | [(3aR,4S,6R,6aS)-6-(6-chloropurin-9-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] acetate |
|---|---|
| PubChem CID | 11696044 |
| Molecular Formula | C15H17ClN4O4 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | [(3aR,4S,6R,6aS)-6-(6-chloropurin-9-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](n2cnc3c(Cl)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C15H17ClN4O4/c1-7(21)22-9-4-8(11-12(9)24-15(2,3)23-11)20-6-19-10-13(16)17-5-18-14(10)20/h5-6,8-9,11-12H,4H2,1-3H3/t8-,9+,11+,12-/m1/s1 |
| InChIKey | GTKMIRHQHSBKNA-LLHIFLOGSA-N |
| XLogP | 1.88 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |