C16H25ClN4O3Si — CID 10738837
(1S,2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(6-chloropurin-9-yl)cyclopentane-1,2-diol (PubChem CID 10738837) has the molecular formula C16H25ClN4O3Si and a molecular weight of 384.94 g/mol. Its IUPAC name is (1S,2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(6-chloropurin-9-yl)cyclopentane-1,2-diol.
| Compound Name | (1S,2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(6-chloropurin-9-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 10738837 |
| Molecular Formula | C16H25ClN4O3Si |
| Molecular Weight | 384.94 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | (1S,2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(6-chloropurin-9-yl)cyclopentane-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](n2cnc3c(Cl)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H25ClN4O3Si/c1-16(2,3)25(4,5)24-10-6-9(12(22)13(10)23)21-8-20-11-14(17)18-7-19-15(11)21/h7-10,12-13,22-23H,6H2,1-5H3/t9-,10+,12+,13-/m1/s1 |
| InChIKey | GVXTXADJENWUPN-RSLMWUCJSA-N |
| XLogP | 2.54 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.94 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|