C21H34ClN5O5Si — CID 10529382
tert-butyl N-[tert-butyl(dimethyl)silyl]oxy-N-[(1S,2R,3S,4R)-4-(6-chloropurin-9-yl)-2,3-dihydroxycyclopentyl]carbamate (PubChem CID 10529382) has the molecular formula C21H34ClN5O5Si and a molecular weight of 500.07 g/mol. Its IUPAC name is tert-butyl N-[tert-butyl(dimethyl)silyl]oxy-N-[(1S,2R,3S,4R)-4-(6-chloropurin-9-yl)-2,3-dihydroxycyclopentyl]carbamate.
| Compound Name | tert-butyl N-[tert-butyl(dimethyl)silyl]oxy-N-[(1S,2R,3S,4R)-4-(6-chloropurin-9-yl)-2,3-dihydroxycyclopentyl]carbamate |
|---|---|
| PubChem CID | 10529382 |
| Molecular Formula | C21H34ClN5O5Si |
| Molecular Weight | 500.07 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | tert-butyl N-[tert-butyl(dimethyl)silyl]oxy-N-[(1S,2R,3S,4R)-4-(6-chloropurin-9-yl)-2,3-dihydroxycyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(O[Si](C)(C)C(C)(C)C)[C@H]1C[C@@H](n2cnc3c(Cl)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H34ClN5O5Si/c1-20(2,3)31-19(30)27(32-33(7,8)21(4,5)6)13-9-12(15(28)16(13)29)26-11-25-14-17(22)23-10-24-18(14)26/h10-13,15-16,28-29H,9H2,1-8H3/t12-,13+,15+,16-/m1/s1 |
| InChIKey | LYRBBUMMQVYSKX-BFJAYTPKSA-N |
| XLogP | 3.69 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.07 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|