C20H29ClN4O3Si — CID 174151257
(2S,3R)-7-[tert-butyl(dimethyl)silyl]oxy-3-(6-chloropurin-9-yl)-2,3,3a,4,7,7a-hexahydro-1H-indene-1,2-diol (PubChem CID 174151257) has the molecular formula C20H29ClN4O3Si and a molecular weight of 437.02 g/mol. Its IUPAC name is (2S,3R)-7-[tert-butyl(dimethyl)silyl]oxy-3-(6-chloropurin-9-yl)-2,3,3a,4,7,7a-hexahydro-1H-indene-1,2-diol.
| Compound Name | (2S,3R)-7-[tert-butyl(dimethyl)silyl]oxy-3-(6-chloropurin-9-yl)-2,3,3a,4,7,7a-hexahydro-1H-indene-1,2-diol |
|---|---|
| PubChem CID | 174151257 |
| Molecular Formula | C20H29ClN4O3Si |
| Molecular Weight | 437.02 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (2S,3R)-7-[tert-butyl(dimethyl)silyl]oxy-3-(6-chloropurin-9-yl)-2,3,3a,4,7,7a-hexahydro-1H-indene-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC1C=CCC2C1C(O)[C@@H](O)[C@@H]2n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C20H29ClN4O3Si/c1-20(2,3)29(4,5)28-12-8-6-7-11-13(12)16(26)17(27)15(11)25-10-24-14-18(21)22-9-23-19(14)25/h6,8-13,15-17,26-27H,7H2,1-5H3/t11?,12?,13?,15-,16?,17+/m1/s1 |
| InChIKey | CBJBLDWPGQQGAZ-LXOKCKPSSA-N |
| XLogP | 3.34 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.02 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|