C27H45ClN4O3Si2 — CID 174151408
[(1R,3R,3aS)-2-[tert-butyl(dimethyl)silyl]oxy-1-(6-chloropurin-9-yl)-3-methoxy-2,3,3a,4,5,6-hexahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 174151408) has the molecular formula C27H45ClN4O3Si2 and a molecular weight of 565.31 g/mol. Its IUPAC name is [(1R,3R,3aS)-2-[tert-butyl(dimethyl)silyl]oxy-1-(6-chloropurin-9-yl)-3-methoxy-2,3,3a,4,5,6-hexahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3R,3aS)-2-[tert-butyl(dimethyl)silyl]oxy-1-(6-chloropurin-9-yl)-3-methoxy-2,3,3a,4,5,6-hexahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 174151408 |
| Molecular Formula | C27H45ClN4O3Si2 |
| Molecular Weight | 565.31 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | [(1R,3R,3aS)-2-[tert-butyl(dimethyl)silyl]oxy-1-(6-chloropurin-9-yl)-3-methoxy-2,3,3a,4,5,6-hexahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@H]1C(O[Si](C)(C)C(C)(C)C)[C@H](n2cnc3c(Cl)ncnc32)C2=CCCC(O[Si](C)(C)C(C)(C)C)[C@@H]21 |
| InChI | InChI=1S/C27H45ClN4O3Si2/c1-26(2,3)36(8,9)34-18-14-12-13-17-19(18)22(33-7)23(35-37(10,11)27(4,5)6)21(17)32-16-31-20-24(28)29-15-30-25(20)32/h13,15-16,18-19,21-23H,12,14H2,1-11H3/t18?,19-,21-,22-,23?/m1/s1 |
| InChIKey | SQHPKHNYMCOPLI-KKZGORQHSA-N |
| XLogP | 7.17 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.31 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|