C15H19ClN4O — CID 10757082
6-chloro-9-[(1S,4R)-4-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-yl]purine (PubChem CID 10757082) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 6-chloro-9-[(1S,4R)-4-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-yl]purine.
| Compound Name | 6-chloro-9-[(1S,4R)-4-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-yl]purine |
|---|---|
| PubChem CID | 10757082 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 6-chloro-9-[(1S,4R)-4-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-yl]purine |
| SMILES | CC(C)(C)OC[C@H]1C=C[C@@H](n2cnc3c(Cl)ncnc32)C1 |
| InChI | InChI=1S/C15H19ClN4O/c1-15(2,3)21-7-10-4-5-11(6-10)20-9-19-12-13(16)17-8-18-14(12)20/h4-5,8-11H,6-7H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | XPNOKHYOVUDGFW-WDEREUQCSA-N |
| XLogP | 3.41 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|