C14H16ClN5O2 — CID 101026740
2-[(1R,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]ethyl acetate (PubChem CID 101026740) has the molecular formula C14H16ClN5O2 and a molecular weight of 321.77 g/mol. Its IUPAC name is 2-[(1R,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]ethyl acetate.
| Compound Name | 2-[(1R,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 101026740 |
| Molecular Formula | C14H16ClN5O2 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[(1R,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@@H]1C=C[C@H](n2cnc3c(Cl)nc(N)nc32)C1 |
| InChI | InChI=1S/C14H16ClN5O2/c1-8(21)22-5-4-9-2-3-10(6-9)20-7-17-11-12(15)18-14(16)19-13(11)20/h2-3,7,9-10H,4-6H2,1H3,(H2,16,18,19)/t9-,10-/m0/s1 |
| InChIKey | DSPYVOIHLXNRAX-UWVGGRQHSA-N |
| XLogP | 2.13 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|