C11H13ClN5O3P — CID 156694801
[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methyl dihydrogen phosphite (PubChem CID 156694801) has the molecular formula C11H13ClN5O3P and a molecular weight of 329.68 g/mol. Its IUPAC name is [(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methyl dihydrogen phosphite.
| Compound Name | [(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methyl dihydrogen phosphite |
|---|---|
| PubChem CID | 156694801 |
| Molecular Formula | C11H13ClN5O3P |
| Molecular Weight | 329.68 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | [(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methyl dihydrogen phosphite |
| SMILES | Nc1nc(Cl)c2ncn([C@H]3C=C[C@@H](COP(O)O)C3)c2n1 |
| InChI | InChI=1S/C11H13ClN5O3P/c12-9-8-10(16-11(13)15-9)17(5-14-8)7-2-1-6(3-7)4-20-21(18)19/h1-2,5-7,18-19H,3-4H2,(H2,13,15,16)/t6-,7+/m1/s1 |
| InChIKey | GLFKVEDLSVPELX-RQJHMYQMSA-N |
| XLogP | 1.41 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.68 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|