C21H23BrClN6O5P — CID 153397061
methyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methoxy-(4-bromophenoxy)phosphoryl]amino]propanoate (PubChem CID 153397061) has the molecular formula C21H23BrClN6O5P and a molecular weight of 585.78 g/mol. Its IUPAC name is methyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methoxy-(4-bromophenoxy)phosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methoxy-(4-bromophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 153397061 |
| Molecular Formula | C21H23BrClN6O5P |
| Molecular Weight | 585.78 g/mol |
| Exact Mass | 584.03 |
| IUPAC Name | methyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methoxy-(4-bromophenoxy)phosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@@H]1C=C[C@H](n2cnc3c(Cl)nc(N)nc32)C1)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H23BrClN6O5P/c1-12(20(30)32-2)28-35(31,34-16-7-4-14(22)5-8-16)33-10-13-3-6-15(9-13)29-11-25-17-18(23)26-21(24)27-19(17)29/h3-8,11-13,15H,9-10H2,1-2H3,(H,28,31)(H2,24,26,27)/t12-,13+,15-,35?/m0/s1 |
| InChIKey | QCGOUZVMGPNWTC-DPPNEWDRSA-N |
| XLogP | 4.30 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.78 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|