C26H35N6O8P — CID 153397076
propan-2-yl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(3,5-dimethoxyphenoxy)phosphoryl]amino]propanoate (PubChem CID 153397076) has the molecular formula C26H35N6O8P and a molecular weight of 590.57 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(3,5-dimethoxyphenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(3,5-dimethoxyphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 153397076 |
| Molecular Formula | C26H35N6O8P |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(3,5-dimethoxyphenoxy)phosphoryl]amino]propanoate |
| SMILES | COc1cc(OC)cc(OP(=O)(N[C@@H](C)C(=O)OC(C)C)OC[C@@H]2C=C[C@H](n3cnc4c(OC)nc(N)nc43)C2)c1 |
| InChI | InChI=1S/C26H35N6O8P/c1-15(2)39-25(33)16(3)31-41(34,40-21-11-19(35-4)10-20(12-21)36-5)38-13-17-7-8-18(9-17)32-14-28-22-23(32)29-26(27)30-24(22)37-6/h7-8,10-12,14-18H,9,13H2,1-6H3,(H,31,34)(H2,27,29,30)/t16-,17+,18-,41?/m0/s1 |
| InChIKey | MFHRYANOBHOJLM-ZVKHJDSASA-N |
| XLogP | 3.68 |
| TPSA | 171.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|